About 2-chloropentanedial
2-chloropentanedial (PubChem CID 22743515) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is 2-chloropentanedial.
Molecular Properties
| Compound Name | 2-chloropentanedial |
| PubChem CID | 22743515 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 2-chloropentanedial |
| SMILES | O=CCCC(Cl)C=O |
| InChI | InChI=1S/C5H7ClO2/c6-5(4-8)2-1-3-7/h3-5H,1-2H2 |
| InChIKey | KHLSIPLPTLBNGM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropentanedial?
The IUPAC name of 2-chloropentanedial (CID 22743515) is 2-chloropentanedial.
What is the SMILES notation for 2-chloropentanedial?
The canonical SMILES for 2-chloropentanedial is O=CCCC(Cl)C=O.
What is the InChIKey of 2-chloropentanedial?
The InChIKey is KHLSIPLPTLBNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c6-5(4-8)2-1-3-7/h3-5H,1-2H2.
What are the key properties of 2-chloropentanedial?
2-chloropentanedial has a molecular weight of 134.56 g/mol, XLogP of 0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropentanedial is sourced from PubChem (CID 22743515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).