C13H16N2O3S — CID 22743969
1-[1-(cyclohexen-1-yl)prop-2-enylsulfanyl]-1,3-diazinane-2,4,6-trione (PubChem CID 22743969) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[1-(cyclohexen-1-yl)prop-2-enylsulfanyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[1-(cyclohexen-1-yl)prop-2-enylsulfanyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22743969 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-[1-(cyclohexen-1-yl)prop-2-enylsulfanyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CC(SN1C(=O)CC(=O)NC1=O)C1=CCCCC1 |
| InChI | InChI=1S/C13H16N2O3S/c1-2-10(9-6-4-3-5-7-9)19-15-12(17)8-11(16)14-13(15)18/h2,6,10H,1,3-5,7-8H2,(H,14,16,18) |
| InChIKey | IEQAFBAAESSWBV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|