About 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one
4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 22745267) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 22745267 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | NCc1cccc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C8H9N3O/c9-4-5-2-1-3-6-7(5)11-8(12)10-6/h1-3H,4,9H2,(H2,10,11,12) |
| InChIKey | NVVDOIMXXJAZJD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one (CID 22745267) is 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one is NCc1cccc2[nH]c(=O)[nH]c12.
What is the InChIKey of 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one?
The InChIKey is NVVDOIMXXJAZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-4-5-2-1-3-6-7(5)11-8(12)10-6/h1-3H,4,9H2,(H2,10,11,12).
What are the key properties of 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one?
4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one has a molecular weight of 163.18 g/mol, XLogP of 0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 22745267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).