About methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate
methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 22745299) has the molecular formula C18H25N5O3
and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate |
| PubChem CID | 22745299 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(N2CCC(n3c(=O)[nH]c4ncccc43)CC2)CC1 |
| InChI | InChI=1S/C18H25N5O3/c1-26-18(25)22-11-4-13(5-12-22)21-9-6-14(7-10-21)23-15-3-2-8-19-16(15)20-17(23)24/h2-3,8,13-14H,4-7,9-12H2,1H3,(H,19,20,24) |
| InChIKey | ROCWSXDEJAMYHE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate?
The IUPAC name of methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate (CID 22745299) is methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate.
What is the SMILES notation for methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate?
The canonical SMILES for methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate is COC(=O)N1CCC(N2CCC(n3c(=O)[nH]c4ncccc43)CC2)CC1.
What is the InChIKey of methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate?
The InChIKey is ROCWSXDEJAMYHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O3/c1-26-18(25)22-11-4-13(5-12-22)21-9-6-14(7-10-21)23-15-3-2-8-19-16(15)20-17(23)24/h2-3,8,13-14H,4-7,9-12H2,1H3,(H,19,20,24).
What are the key properties of methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate?
methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate has a molecular weight of 359.43 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]piperidine-1-carboxylate is sourced from PubChem (CID 22745299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).