About [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol
[4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol (PubChem CID 22745420) has the molecular formula C17H14F2N2O4S
and a molecular weight of 380.37 g/mol. Its IUPAC name is [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol |
| PubChem CID | 22745420 |
| Molecular Formula | C17H14F2N2O4S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol |
| SMILES | Cc1cccc(-c2noc(CO)c2-c2cc(F)c(S(C)(=O)=O)c(F)c2)n1 |
| InChI | InChI=1S/C17H14F2N2O4S/c1-9-4-3-5-13(20-9)16-15(14(8-22)25-21-16)10-6-11(18)17(12(19)7-10)26(2,23)24/h3-7,22H,8H2,1-2H3 |
| InChIKey | REQBSGKWTFNMQT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol?
The IUPAC name of [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol (CID 22745420) is [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol is Cc1cccc(-c2noc(CO)c2-c2cc(F)c(S(C)(=O)=O)c(F)c2)n1.
What is the InChIKey of [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol?
The InChIKey is REQBSGKWTFNMQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O4S/c1-9-4-3-5-13(20-9)16-15(14(8-22)25-21-16)10-6-11(18)17(12(19)7-10)26(2,23)24/h3-7,22H,8H2,1-2H3.
What are the key properties of [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol?
[4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol has a molecular weight of 380.37 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-difluoro-4-methylsulfonylphenyl)-3-(6-methyl-2-pyridinyl)-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 22745420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).