About 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide
4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 22745577) has the molecular formula C16H9F5N2O3S
and a molecular weight of 404.32 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide |
| PubChem CID | 22745577 |
| Molecular Formula | C16H9F5N2O3S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)cc(-c2c(-c3cccc(F)c3)noc2C(F)F)cc1F |
| InChI | InChI=1S/C16H9F5N2O3S/c17-9-3-1-2-7(4-9)13-12(14(16(20)21)26-23-13)8-5-10(18)15(11(19)6-8)27(22,24)25/h1-6,16H,(H2,22,24,25) |
| InChIKey | JBESSPDEXQLUPR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
The IUPAC name of 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide (CID 22745577) is 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide.
What is the SMILES notation for 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
The canonical SMILES for 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide is NS(=O)(=O)c1c(F)cc(-c2c(-c3cccc(F)c3)noc2C(F)F)cc1F.
What is the InChIKey of 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
The InChIKey is JBESSPDEXQLUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9F5N2O3S/c17-9-3-1-2-7(4-9)13-12(14(16(20)21)26-23-13)8-5-10(18)15(11(19)6-8)27(22,24)25/h1-6,16H,(H2,22,24,25).
What are the key properties of 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide has a molecular weight of 404.32 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(difluoromethyl)-3-(3-fluorophenyl)-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide is sourced from PubChem (CID 22745577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).