About 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide
4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 22745952) has the molecular formula C17H13ClF2N2O3S
and a molecular weight of 398.82 g/mol. Its IUPAC name is 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide |
| PubChem CID | 22745952 |
| Molecular Formula | C17H13ClF2N2O3S |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1cc(-c2noc(C)c2-c2cc(F)c(S(N)(=O)=O)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C17H13ClF2N2O3S/c1-8-5-10(3-4-12(8)18)16-15(9(2)25-22-16)11-6-13(19)17(14(20)7-11)26(21,23)24/h3-7H,1-2H3,(H2,21,23,24) |
| InChIKey | QNHPRJSBMBQLDE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
The IUPAC name of 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide (CID 22745952) is 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide.
What is the SMILES notation for 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
The canonical SMILES for 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide is Cc1cc(-c2noc(C)c2-c2cc(F)c(S(N)(=O)=O)c(F)c2)ccc1Cl.
What is the InChIKey of 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
The InChIKey is QNHPRJSBMBQLDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClF2N2O3S/c1-8-5-10(3-4-12(8)18)16-15(9(2)25-22-16)11-6-13(19)17(14(20)7-11)26(21,23)24/h3-7H,1-2H3,(H2,21,23,24).
What are the key properties of 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide?
4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide has a molecular weight of 398.82 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-chloro-3-methylphenyl)-5-methyl-1,2-oxazol-4-yl]-2,6-difluorobenzenesulfonamide is sourced from PubChem (CID 22745952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).