C10H6Cl2N2O3 — CID 2274644
1-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2274644) has the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2274644 |
| Molecular Formula | C10H6Cl2N2O3 |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2ccc(Cl)cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C10H6Cl2N2O3/c11-5-1-2-7(6(12)3-5)14-9(16)4-8(15)13-10(14)17/h1-3H,4H2,(H,13,15,17) |
| InChIKey | PVQFQDKLSGQFMD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|