About 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine
3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine (PubChem CID 22747212) has the molecular formula C17H13F2NO2S2
and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine.
Molecular Properties
| Compound Name | 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine |
| PubChem CID | 22747212 |
| Molecular Formula | C17H13F2NO2S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine |
| SMILES | Cc1ncccc1-c1cscc1-c1cc(F)c(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C17H13F2NO2S2/c1-10-12(4-3-5-20-10)14-9-23-8-13(14)11-6-15(18)17(16(19)7-11)24(2,21)22/h3-9H,1-2H3 |
| InChIKey | FTZKUDFJGPFURY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine?
The IUPAC name of 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine (CID 22747212) is 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine.
What is the SMILES notation for 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine?
The canonical SMILES for 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine is Cc1ncccc1-c1cscc1-c1cc(F)c(S(C)(=O)=O)c(F)c1.
What is the InChIKey of 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine?
The InChIKey is FTZKUDFJGPFURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2NO2S2/c1-10-12(4-3-5-20-10)14-9-23-8-13(14)11-6-15(18)17(16(19)7-11)24(2,21)22/h3-9H,1-2H3.
What are the key properties of 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine?
3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine has a molecular weight of 365.43 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-difluoro-4-methylsulfonylphenyl)thiophen-3-yl]-2-methylpyridine is sourced from PubChem (CID 22747212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).