About 2-ethyl-1-hydroxyindole
2-ethyl-1-hydroxyindole (PubChem CID 22747467) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-ethyl-1-hydroxyindole.
Molecular Properties
| Compound Name | 2-ethyl-1-hydroxyindole |
| PubChem CID | 22747467 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-ethyl-1-hydroxyindole |
| SMILES | CCc1cc2ccccc2n1O |
| InChI | InChI=1S/C10H11NO/c1-2-9-7-8-5-3-4-6-10(8)11(9)12/h3-7,12H,2H2,1H3 |
| InChIKey | CWZPMGWAOGENRT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-hydroxyindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-hydroxyindole?
The IUPAC name of 2-ethyl-1-hydroxyindole (CID 22747467) is 2-ethyl-1-hydroxyindole.
What is the SMILES notation for 2-ethyl-1-hydroxyindole?
The canonical SMILES for 2-ethyl-1-hydroxyindole is CCc1cc2ccccc2n1O.
What is the InChIKey of 2-ethyl-1-hydroxyindole?
The InChIKey is CWZPMGWAOGENRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-9-7-8-5-3-4-6-10(8)11(9)12/h3-7,12H,2H2,1H3.
What are the key properties of 2-ethyl-1-hydroxyindole?
2-ethyl-1-hydroxyindole has a molecular weight of 161.20 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-hydroxyindole is sourced from PubChem (CID 22747467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).