C14H15FN2O2S — CID 22748339
2-(2-fluoro-4-methoxyphenyl)-3-sulfanylidene-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-1-one (PubChem CID 22748339) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(2-fluoro-4-methoxyphenyl)-3-sulfanylidene-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-1-one.
| Compound Name | 2-(2-fluoro-4-methoxyphenyl)-3-sulfanylidene-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-1-one |
|---|---|
| PubChem CID | 22748339 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-(2-fluoro-4-methoxyphenyl)-3-sulfanylidene-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-1-one |
| SMILES | COc1ccc(N2C(=O)C3CCCCN3C2=S)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-19-9-5-6-11(10(15)8-9)17-13(18)12-4-2-3-7-16(12)14(17)20/h5-6,8,12H,2-4,7H2,1H3 |
| InChIKey | BNWVGKVDDXFQCV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|