About 3-pyridin-3-yl-1,2-oxazolidine
3-pyridin-3-yl-1,2-oxazolidine (PubChem CID 22748551) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-pyridin-3-yl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3-pyridin-3-yl-1,2-oxazolidine |
| PubChem CID | 22748551 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-pyridin-3-yl-1,2-oxazolidine |
| SMILES | c1cncc(C2CCON2)c1 |
| InChI | InChI=1S/C8H10N2O/c1-2-7(6-9-4-1)8-3-5-11-10-8/h1-2,4,6,8,10H,3,5H2 |
| InChIKey | XGQHPKHFETWWKN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyridin-3-yl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-yl-1,2-oxazolidine?
The IUPAC name of 3-pyridin-3-yl-1,2-oxazolidine (CID 22748551) is 3-pyridin-3-yl-1,2-oxazolidine.
What is the SMILES notation for 3-pyridin-3-yl-1,2-oxazolidine?
The canonical SMILES for 3-pyridin-3-yl-1,2-oxazolidine is c1cncc(C2CCON2)c1.
What is the InChIKey of 3-pyridin-3-yl-1,2-oxazolidine?
The InChIKey is XGQHPKHFETWWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-2-7(6-9-4-1)8-3-5-11-10-8/h1-2,4,6,8,10H,3,5H2.
What are the key properties of 3-pyridin-3-yl-1,2-oxazolidine?
3-pyridin-3-yl-1,2-oxazolidine has a molecular weight of 150.18 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-yl-1,2-oxazolidine is sourced from PubChem (CID 22748551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).