About 2,4-dimethylpentan-1-ol
2,4-dimethylpentan-1-ol (PubChem CID 22749) has the molecular formula C7H16O
and a molecular weight of 116.20 g/mol. Its IUPAC name is 2,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-1-ol |
| PubChem CID | 22749 |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.20 g/mol |
| Exact Mass | 116.12 |
| IUPAC Name | 2,4-dimethylpentan-1-ol |
| SMILES | CC(C)CC(C)CO |
| InChI | InChI=1S/C7H16O/c1-6(2)4-7(3)5-8/h6-8H,4-5H2,1-3H3 |
| InChIKey | OVOVDHYEOQJKMD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-1-ol?
The IUPAC name of 2,4-dimethylpentan-1-ol (CID 22749) is 2,4-dimethylpentan-1-ol.
What is the SMILES notation for 2,4-dimethylpentan-1-ol?
The canonical SMILES for 2,4-dimethylpentan-1-ol is CC(C)CC(C)CO.
What is the InChIKey of 2,4-dimethylpentan-1-ol?
The InChIKey is OVOVDHYEOQJKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O/c1-6(2)4-7(3)5-8/h6-8H,4-5H2,1-3H3.
What are the key properties of 2,4-dimethylpentan-1-ol?
2,4-dimethylpentan-1-ol has a molecular weight of 116.20 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-1-ol is sourced from PubChem (CID 22749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).