C17H12F4N2O — CID 2274914
[2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methanol (PubChem CID 2274914) has the molecular formula C17H12F4N2O and a molecular weight of 336.29 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methanol.
| Compound Name | [2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 2274914 |
| Molecular Formula | C17H12F4N2O |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methanol |
| SMILES | Cc1cc(-c2ccccc2)n(-c2c(F)c(F)c(CO)c(F)c2F)n1 |
| InChI | InChI=1S/C17H12F4N2O/c1-9-7-12(10-5-3-2-4-6-10)23(22-9)17-15(20)13(18)11(8-24)14(19)16(17)21/h2-7,24H,8H2,1H3 |
| InChIKey | YAGJAKSEGCQDQB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|