About N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide
N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide (PubChem CID 22749213) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide |
| PubChem CID | 22749213 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide |
| SMILES | CCC(=O)NCCN1C=CCNC1 |
| InChI | InChI=1S/C9H17N3O/c1-2-9(13)11-5-7-12-6-3-4-10-8-12/h3,6,10H,2,4-5,7-8H2,1H3,(H,11,13) |
| InChIKey | OKKOLJBWBPNNNZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide?
The IUPAC name of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide (CID 22749213) is N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide.
What is the SMILES notation for N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide?
The canonical SMILES for N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide is CCC(=O)NCCN1C=CCNC1.
What is the InChIKey of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide?
The InChIKey is OKKOLJBWBPNNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-2-9(13)11-5-7-12-6-3-4-10-8-12/h3,6,10H,2,4-5,7-8H2,1H3,(H,11,13).
What are the key properties of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide?
N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide has a molecular weight of 183.25 g/mol, XLogP of -0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]propanamide is sourced from PubChem (CID 22749213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).