About benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne
benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne (PubChem CID 22749294) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne.
Molecular Properties
| Compound Name | benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne |
| PubChem CID | 22749294 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne |
| SMILES | C#CCOCC#C.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C6H6O/c7-5-1-2-6(8)4-3-5;1-3-5-7-6-4-2/h1-4,7-8H;1-2H,5-6H2 |
| InChIKey | MVASJDKGGQWMSK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne?
The IUPAC name of benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne (CID 22749294) is benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne.
What is the SMILES notation for benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne?
The canonical SMILES for benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne is C#CCOCC#C.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne?
The InChIKey is MVASJDKGGQWMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C6H6O/c7-5-1-2-6(8)4-3-5;1-3-5-7-6-4-2/h1-4,7-8H;1-2H,5-6H2.
What are the key properties of benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne?
benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne has a molecular weight of 204.22 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;3-prop-2-ynoxyprop-1-yne is sourced from PubChem (CID 22749294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).