About 1-bromo-9-ethoxy-4,9-dimethylundecane
1-bromo-9-ethoxy-4,9-dimethylundecane (PubChem CID 22749782) has the molecular formula C15H31BrO
and a molecular weight of 307.32 g/mol. Its IUPAC name is 1-bromo-9-ethoxy-4,9-dimethylundecane.
Molecular Properties
| Compound Name | 1-bromo-9-ethoxy-4,9-dimethylundecane |
| PubChem CID | 22749782 |
| Molecular Formula | C15H31BrO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-bromo-9-ethoxy-4,9-dimethylundecane |
| SMILES | CCOC(C)(CC)CCCCC(C)CCCBr |
| InChI | InChI=1S/C15H31BrO/c1-5-15(4,17-6-2)12-8-7-10-14(3)11-9-13-16/h14H,5-13H2,1-4H3 |
| InChIKey | UEWQCPQTENOSOP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-9-ethoxy-4,9-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9-ethoxy-4,9-dimethylundecane?
The IUPAC name of 1-bromo-9-ethoxy-4,9-dimethylundecane (CID 22749782) is 1-bromo-9-ethoxy-4,9-dimethylundecane.
What is the SMILES notation for 1-bromo-9-ethoxy-4,9-dimethylundecane?
The canonical SMILES for 1-bromo-9-ethoxy-4,9-dimethylundecane is CCOC(C)(CC)CCCCC(C)CCCBr.
What is the InChIKey of 1-bromo-9-ethoxy-4,9-dimethylundecane?
The InChIKey is UEWQCPQTENOSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31BrO/c1-5-15(4,17-6-2)12-8-7-10-14(3)11-9-13-16/h14H,5-13H2,1-4H3.
What are the key properties of 1-bromo-9-ethoxy-4,9-dimethylundecane?
1-bromo-9-ethoxy-4,9-dimethylundecane has a molecular weight of 307.32 g/mol, XLogP of 5.56, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9-ethoxy-4,9-dimethylundecane is sourced from PubChem (CID 22749782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).