About (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene
(E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene (PubChem CID 22749808) has the molecular formula C13H25BrO
and a molecular weight of 277.25 g/mol. Its IUPAC name is (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene.
Molecular Properties
| Compound Name | (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene |
| PubChem CID | 22749808 |
| Molecular Formula | C13H25BrO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene |
| SMILES | CCOC(C)(CC)CCC/C(C)=C/CBr |
| InChI | InChI=1S/C13H25BrO/c1-5-13(4,15-6-2)10-7-8-12(3)9-11-14/h9H,5-8,10-11H2,1-4H3/b12-9+ |
| InChIKey | DNQVBXIFXVQRRT-FMIVXFBMSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene?
The IUPAC name of (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene (CID 22749808) is (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene.
What is the SMILES notation for (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene?
The canonical SMILES for (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene is CCOC(C)(CC)CCC/C(C)=C/CBr.
What is the InChIKey of (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene?
The InChIKey is DNQVBXIFXVQRRT-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H25BrO/c1-5-13(4,15-6-2)10-7-8-12(3)9-11-14/h9H,5-8,10-11H2,1-4H3/b12-9+.
What are the key properties of (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene?
(E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene has a molecular weight of 277.25 g/mol, XLogP of 4.70, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-bromo-7-ethoxy-3,7-dimethylnon-2-ene is sourced from PubChem (CID 22749808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).