About 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene
1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene (PubChem CID 22749820) has the molecular formula C19H32O3S
and a molecular weight of 340.53 g/mol. Its IUPAC name is 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene.
Molecular Properties
| Compound Name | 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene |
| PubChem CID | 22749820 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene |
| SMILES | CCc1ccc(S(=O)(=O)CCC(C)CCCC(C)(C)OC)cc1 |
| InChI | InChI=1S/C19H32O3S/c1-6-17-9-11-18(12-10-17)23(20,21)15-13-16(2)8-7-14-19(3,4)22-5/h9-12,16H,6-8,13-15H2,1-5H3 |
| InChIKey | XOBRPHVTYFTSHY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene?
The IUPAC name of 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene (CID 22749820) is 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene.
What is the SMILES notation for 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene?
The canonical SMILES for 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene is CCc1ccc(S(=O)(=O)CCC(C)CCCC(C)(C)OC)cc1.
What is the InChIKey of 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene?
The InChIKey is XOBRPHVTYFTSHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O3S/c1-6-17-9-11-18(12-10-17)23(20,21)15-13-16(2)8-7-14-19(3,4)22-5/h9-12,16H,6-8,13-15H2,1-5H3.
What are the key properties of 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene?
1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene has a molecular weight of 340.53 g/mol, XLogP of 4.64, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(7-methoxy-3,7-dimethyloctyl)sulfonylbenzene is sourced from PubChem (CID 22749820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).