About 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene
1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene (PubChem CID 22749845) has the molecular formula C20H34O2S
and a molecular weight of 338.56 g/mol. Its IUPAC name is 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene.
Molecular Properties
| Compound Name | 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene |
| PubChem CID | 22749845 |
| Molecular Formula | C20H34O2S |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene |
| SMILES | CCOC(C)(C)CCCC(C)CCS(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C20H34O2S/c1-6-18-10-12-19(13-11-18)23(21)16-14-17(3)9-8-15-20(4,5)22-7-2/h10-13,17H,6-9,14-16H2,1-5H3 |
| InChIKey | TWGSWWJCQVVFNI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene?
The IUPAC name of 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene (CID 22749845) is 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene.
What is the SMILES notation for 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene?
The canonical SMILES for 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene is CCOC(C)(C)CCCC(C)CCS(=O)c1ccc(CC)cc1.
What is the InChIKey of 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene?
The InChIKey is TWGSWWJCQVVFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2S/c1-6-18-10-12-19(13-11-18)23(21)16-14-17(3)9-8-15-20(4,5)22-7-2/h10-13,17H,6-9,14-16H2,1-5H3.
What are the key properties of 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene?
1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene has a molecular weight of 338.56 g/mol, XLogP of 5.37, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-ethoxy-3,7-dimethyloctyl)sulfinyl-4-ethylbenzene is sourced from PubChem (CID 22749845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).