About N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide
N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide (PubChem CID 22750372) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide |
| PubChem CID | 22750372 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NC(C)C1=NCCN1 |
| InChI | InChI=1S/C7H13N3O/c1-5(10-6(2)11)7-8-3-4-9-7/h5H,3-4H2,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | CXZPOAPAENDHRR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide?
The IUPAC name of N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide (CID 22750372) is N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide.
What is the SMILES notation for N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide?
The canonical SMILES for N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide is CC(=O)NC(C)C1=NCCN1.
What is the InChIKey of N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide?
The InChIKey is CXZPOAPAENDHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-5(10-6(2)11)7-8-3-4-9-7/h5H,3-4H2,1-2H3,(H,8,9)(H,10,11).
What are the key properties of N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide?
N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide has a molecular weight of 155.20 g/mol, XLogP of -0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,5-dihydro-1H-imidazol-2-yl)ethyl]acetamide is sourced from PubChem (CID 22750372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).