About 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol
8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol (PubChem CID 22750441) has the molecular formula C26H32N2O
and a molecular weight of 388.56 g/mol. Its IUPAC name is 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol.
Molecular Properties
| Compound Name | 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol |
| PubChem CID | 22750441 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol |
| SMILES | CC(CCCC(C)(C)O)CC(C1C=Nc2ccccc21)C1C=Nc2ccccc21 |
| InChI | InChI=1S/C26H32N2O/c1-18(9-8-14-26(2,3)29)15-21(22-16-27-24-12-6-4-10-19(22)24)23-17-28-25-13-7-5-11-20(23)25/h4-7,10-13,16-18,21-23,29H,8-9,14-15H2,1-3H3 |
| InChIKey | QWWDRNFZSAZCQE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol?
The IUPAC name of 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol (CID 22750441) is 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol.
What is the SMILES notation for 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol?
The canonical SMILES for 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol is CC(CCCC(C)(C)O)CC(C1C=Nc2ccccc21)C1C=Nc2ccccc21.
What is the InChIKey of 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol?
The InChIKey is QWWDRNFZSAZCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O/c1-18(9-8-14-26(2,3)29)15-21(22-16-27-24-12-6-4-10-19(22)24)23-17-28-25-13-7-5-11-20(23)25/h4-7,10-13,16-18,21-23,29H,8-9,14-15H2,1-3H3.
What are the key properties of 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol?
8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol has a molecular weight of 388.56 g/mol, XLogP of 6.57, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-bis(3H-indol-3-yl)-2,6-dimethyloctan-2-ol is sourced from PubChem (CID 22750441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).