C9H11F5O5 — CID 22750743
2-hydroxy-2-(2,3,5,5,6-pentafluoro-3,6-dimethyl-1,4-dioxan-2-yl)propanoic acid (PubChem CID 22750743) has the molecular formula C9H11F5O5 and a molecular weight of 294.17 g/mol. Its IUPAC name is 2-hydroxy-2-(2,3,5,5,6-pentafluoro-3,6-dimethyl-1,4-dioxan-2-yl)propanoic acid.
| Compound Name | 2-hydroxy-2-(2,3,5,5,6-pentafluoro-3,6-dimethyl-1,4-dioxan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 22750743 |
| Molecular Formula | C9H11F5O5 |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-hydroxy-2-(2,3,5,5,6-pentafluoro-3,6-dimethyl-1,4-dioxan-2-yl)propanoic acid |
| SMILES | CC1(F)OC(F)(C(C)(O)C(=O)O)C(C)(F)OC1(F)F |
| InChI | InChI=1S/C9H11F5O5/c1-5(17,4(15)16)8(12)6(2,10)19-9(13,14)7(3,11)18-8/h17H,1-3H3,(H,15,16) |
| InChIKey | ZKRIJIRCJPDJIO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |