About 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea
3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea (PubChem CID 22751091) has the molecular formula C23H33ClN2O3S
and a molecular weight of 453.05 g/mol. Its IUPAC name is 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea.
Molecular Properties
| Compound Name | 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea |
| PubChem CID | 22751091 |
| Molecular Formula | C23H33ClN2O3S |
| Molecular Weight | 453.05 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea |
| SMILES | C/C(=C(/C)S(=O)(=O)NC(=O)N(C1CCCCC1)C1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H33ClN2O3S/c1-17(19-13-15-20(24)16-14-19)18(2)30(28,29)25-23(27)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h13-16,21-22H,3-12H2,1-2H3,(H,25,27)/b18-17+ |
| InChIKey | ANVQPVQCEQIKCV-ISLYRVAYSA-N |
| XLogP | 6.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.05 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea?
The IUPAC name of 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea (CID 22751091) is 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea.
What is the SMILES notation for 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea?
The canonical SMILES for 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea is C/C(=C(/C)S(=O)(=O)NC(=O)N(C1CCCCC1)C1CCCCC1)c1ccc(Cl)cc1.
What is the InChIKey of 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea?
The InChIKey is ANVQPVQCEQIKCV-ISLYRVAYSA-N. The full InChI is InChI=1S/C23H33ClN2O3S/c1-17(19-13-15-20(24)16-14-19)18(2)30(28,29)25-23(27)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h13-16,21-22H,3-12H2,1-2H3,(H,25,27)/b18-17+.
What are the key properties of 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea?
3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea has a molecular weight of 453.05 g/mol, XLogP of 6.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(4-chlorophenyl)but-2-en-2-yl]sulfonyl-1,1-dicyclohexylurea is sourced from PubChem (CID 22751091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).