About 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol
1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol (PubChem CID 22751156) has the molecular formula C16H22Cl2N2O
and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol.
Molecular Properties
| Compound Name | 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol |
| PubChem CID | 22751156 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol |
| SMILES | CCCCC(O)CN1N=CCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-2-3-5-13(21)11-20-16(6-4-9-19-20)12-7-8-14(17)15(18)10-12/h7-10,13,16,21H,2-6,11H2,1H3 |
| InChIKey | SOKPAGHEUHZGOD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol?
The IUPAC name of 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol (CID 22751156) is 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol.
What is the SMILES notation for 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol?
The canonical SMILES for 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol is CCCCC(O)CN1N=CCCC1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol?
The InChIKey is SOKPAGHEUHZGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22Cl2N2O/c1-2-3-5-13(21)11-20-16(6-4-9-19-20)12-7-8-14(17)15(18)10-12/h7-10,13,16,21H,2-6,11H2,1H3.
What are the key properties of 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol?
1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol has a molecular weight of 329.27 g/mol, XLogP of 4.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-dichlorophenyl)-4,5-dihydro-3H-pyridazin-2-yl]hexan-2-ol is sourced from PubChem (CID 22751156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).