C16H15FO4 — CID 22751507
bicyclo[2.2.0]hexa-1(4),2,5-triene;3-(3-fluorophenoxy)-3-hydroxybutanoic acid (PubChem CID 22751507) has the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1(4),2,5-triene;3-(3-fluorophenoxy)-3-hydroxybutanoic acid.
| Compound Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;3-(3-fluorophenoxy)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22751507 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;3-(3-fluorophenoxy)-3-hydroxybutanoic acid |
| SMILES | CC(O)(CC(=O)O)Oc1cccc(F)c1.c1cc2ccc1=2 |
| InChI | InChI=1S/C10H11FO4.C6H4/c1-10(14,6-9(12)13)15-8-4-2-3-7(11)5-8;1-2-6-4-3-5(1)6/h2-5,14H,6H2,1H3,(H,12,13);1-4H |
| InChIKey | UHZWKSBTZBZTLO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|