C21H25ClO4 — CID 22751524
bicyclo[2.2.0]hexa-1(4),2,5-triene;[3-(4-chlorophenoxy)-3-hydroxybutyl] 3-methylbutanoate (PubChem CID 22751524) has the molecular formula C21H25ClO4 and a molecular weight of 376.88 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1(4),2,5-triene;[3-(4-chlorophenoxy)-3-hydroxybutyl] 3-methylbutanoate.
| Compound Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;[3-(4-chlorophenoxy)-3-hydroxybutyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 22751524 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;[3-(4-chlorophenoxy)-3-hydroxybutyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCCC(C)(O)Oc1ccc(Cl)cc1.c1cc2ccc1=2 |
| InChI | InChI=1S/C15H21ClO4.C6H4/c1-11(2)10-14(17)19-9-8-15(3,18)20-13-6-4-12(16)5-7-13;1-2-6-4-3-5(1)6/h4-7,11,18H,8-10H2,1-3H3;1-4H |
| InChIKey | IWSGHVYBERMTSH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|