C25H40N4O12S4 — CID 22751696
N-ethenylsulfonyl-N-[1,5,5-tris[ethenylsulfonyl(propanoyl)amino]pentyl]propanamide (PubChem CID 22751696) has the molecular formula C25H40N4O12S4 and a molecular weight of 716.88 g/mol. Its IUPAC name is N-ethenylsulfonyl-N-[1,5,5-tris[ethenylsulfonyl(propanoyl)amino]pentyl]propanamide.
| Compound Name | N-ethenylsulfonyl-N-[1,5,5-tris[ethenylsulfonyl(propanoyl)amino]pentyl]propanamide |
|---|---|
| PubChem CID | 22751696 |
| Molecular Formula | C25H40N4O12S4 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.15 |
| IUPAC Name | N-ethenylsulfonyl-N-[1,5,5-tris[ethenylsulfonyl(propanoyl)amino]pentyl]propanamide |
| SMILES | C=CS(=O)(=O)N(C(=O)CC)C(CCCC(N(C(=O)CC)S(=O)(=O)C=C)N(C(=O)CC)S(=O)(=O)C=C)N(C(=O)CC)S(=O)(=O)C=C |
| InChI | InChI=1S/C25H40N4O12S4/c1-9-22(30)26(42(34,35)13-5)20(27(23(31)10-2)43(36,37)14-6)18-17-19-21(28(24(32)11-3)44(38,39)15-7)29(25(33)12-4)45(40,41)16-8/h13-16,20-21H,5-12,17-19H2,1-4H3 |
| InChIKey | FFTLKRZBEGOSGL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 217.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|