About 2-ethoxy-3,4-dimethylhexan-1-amine
2-ethoxy-3,4-dimethylhexan-1-amine (PubChem CID 22751777) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 2-ethoxy-3,4-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 2-ethoxy-3,4-dimethylhexan-1-amine |
| PubChem CID | 22751777 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 2-ethoxy-3,4-dimethylhexan-1-amine |
| SMILES | CCOC(CN)C(C)C(C)CC |
| InChI | InChI=1S/C10H23NO/c1-5-8(3)9(4)10(7-11)12-6-2/h8-10H,5-7,11H2,1-4H3 |
| InChIKey | ZPIHIELORHOHFC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-3,4-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3,4-dimethylhexan-1-amine?
The IUPAC name of 2-ethoxy-3,4-dimethylhexan-1-amine (CID 22751777) is 2-ethoxy-3,4-dimethylhexan-1-amine.
What is the SMILES notation for 2-ethoxy-3,4-dimethylhexan-1-amine?
The canonical SMILES for 2-ethoxy-3,4-dimethylhexan-1-amine is CCOC(CN)C(C)C(C)CC.
What is the InChIKey of 2-ethoxy-3,4-dimethylhexan-1-amine?
The InChIKey is ZPIHIELORHOHFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-5-8(3)9(4)10(7-11)12-6-2/h8-10H,5-7,11H2,1-4H3.
What are the key properties of 2-ethoxy-3,4-dimethylhexan-1-amine?
2-ethoxy-3,4-dimethylhexan-1-amine has a molecular weight of 173.30 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3,4-dimethylhexan-1-amine is sourced from PubChem (CID 22751777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).