About 1-aminoethyl 2-cyano-3-methylbut-2-enoate
1-aminoethyl 2-cyano-3-methylbut-2-enoate (PubChem CID 22751782) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-aminoethyl 2-cyano-3-methylbut-2-enoate.
Molecular Properties
| Compound Name | 1-aminoethyl 2-cyano-3-methylbut-2-enoate |
| PubChem CID | 22751782 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-aminoethyl 2-cyano-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C#N)C(=O)OC(C)N |
| InChI | InChI=1S/C8H12N2O2/c1-5(2)7(4-9)8(11)12-6(3)10/h6H,10H2,1-3H3 |
| InChIKey | OMNKQROFSFHZMI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl 2-cyano-3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl 2-cyano-3-methylbut-2-enoate?
The IUPAC name of 1-aminoethyl 2-cyano-3-methylbut-2-enoate (CID 22751782) is 1-aminoethyl 2-cyano-3-methylbut-2-enoate.
What is the SMILES notation for 1-aminoethyl 2-cyano-3-methylbut-2-enoate?
The canonical SMILES for 1-aminoethyl 2-cyano-3-methylbut-2-enoate is CC(C)=C(C#N)C(=O)OC(C)N.
What is the InChIKey of 1-aminoethyl 2-cyano-3-methylbut-2-enoate?
The InChIKey is OMNKQROFSFHZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5(2)7(4-9)8(11)12-6(3)10/h6H,10H2,1-3H3.
What are the key properties of 1-aminoethyl 2-cyano-3-methylbut-2-enoate?
1-aminoethyl 2-cyano-3-methylbut-2-enoate has a molecular weight of 168.20 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl 2-cyano-3-methylbut-2-enoate is sourced from PubChem (CID 22751782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).