C16H20N2O4 — CID 22752336
1-[(6-methoxy-2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-3-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 22752336) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[(6-methoxy-2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-3-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(6-methoxy-2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-3-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22752336 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[(6-methoxy-2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-3-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1)NC(CN1C(=O)CCC1=O)C(C)(C)O2 |
| InChI | InChI=1S/C16H20N2O4/c1-16(2)13(9-18-14(19)6-7-15(18)20)17-11-8-10(21-3)4-5-12(11)22-16/h4-5,8,13,17H,6-7,9H2,1-3H3 |
| InChIKey | VGLSVEBDXPECRP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|