About 2-(2-methoxyphenyl)-2H-1,4-benzoxazine
2-(2-methoxyphenyl)-2H-1,4-benzoxazine (PubChem CID 22752537) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-2H-1,4-benzoxazine |
| PubChem CID | 22752537 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-(2-methoxyphenyl)-2H-1,4-benzoxazine |
| SMILES | COc1ccccc1C1C=Nc2ccccc2O1 |
| InChI | InChI=1S/C15H13NO2/c1-17-13-8-4-2-6-11(13)15-10-16-12-7-3-5-9-14(12)18-15/h2-10,15H,1H3 |
| InChIKey | CTTIUNFDNPQXPG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methoxyphenyl)-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-2H-1,4-benzoxazine?
The IUPAC name of 2-(2-methoxyphenyl)-2H-1,4-benzoxazine (CID 22752537) is 2-(2-methoxyphenyl)-2H-1,4-benzoxazine.
What is the SMILES notation for 2-(2-methoxyphenyl)-2H-1,4-benzoxazine?
The canonical SMILES for 2-(2-methoxyphenyl)-2H-1,4-benzoxazine is COc1ccccc1C1C=Nc2ccccc2O1.
What is the InChIKey of 2-(2-methoxyphenyl)-2H-1,4-benzoxazine?
The InChIKey is CTTIUNFDNPQXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c1-17-13-8-4-2-6-11(13)15-10-16-12-7-3-5-9-14(12)18-15/h2-10,15H,1H3.
What are the key properties of 2-(2-methoxyphenyl)-2H-1,4-benzoxazine?
2-(2-methoxyphenyl)-2H-1,4-benzoxazine has a molecular weight of 239.27 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-2H-1,4-benzoxazine is sourced from PubChem (CID 22752537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).