C28H26F2NO2+ — CID 22752900
1-[4,4-bis(4-fluorophenyl)butyl]-4-(2-methoxyphenoxy)pyridin-1-ium (PubChem CID 22752900) has the molecular formula C28H26F2NO2+ and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-4-(2-methoxyphenoxy)pyridin-1-ium.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-(2-methoxyphenoxy)pyridin-1-ium |
|---|---|
| PubChem CID | 22752900 |
| Molecular Formula | C28H26F2NO2+ |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-(2-methoxyphenoxy)pyridin-1-ium |
| SMILES | COc1ccccc1Oc1cc[n+](CCCC(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H26F2NO2/c1-32-27-6-2-3-7-28(27)33-25-16-19-31(20-17-25)18-4-5-26(21-8-12-23(29)13-9-21)22-10-14-24(30)15-11-22/h2-3,6-17,19-20,26H,4-5,18H2,1H3/q+1 |
| InChIKey | VBXPNMUHNUJUEB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|