About [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate
[2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (PubChem CID 22752915) has the molecular formula C22H29NO6
and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate.
Molecular Properties
| Compound Name | [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
| PubChem CID | 22752915 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
| SMILES | CC(N)(Cc1ccc(O)c(O)c1)C(=O)OCC(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29NO6/c1-21(23,8-13-2-3-17(24)18(25)7-13)20(27)28-12-19(26)29-22-9-14-4-15(10-22)6-16(5-14)11-22/h2-3,7,14-16,24-25H,4-6,8-12,23H2,1H3 |
| InChIKey | FMGIORMBQHYOBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate?
The IUPAC name of [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (CID 22752915) is [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate.
What is the SMILES notation for [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate?
The canonical SMILES for [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate is CC(N)(Cc1ccc(O)c(O)c1)C(=O)OCC(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate?
The InChIKey is FMGIORMBQHYOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO6/c1-21(23,8-13-2-3-17(24)18(25)7-13)20(27)28-12-19(26)29-22-9-14-4-15(10-22)6-16(5-14)11-22/h2-3,7,14-16,24-25H,4-6,8-12,23H2,1H3.
What are the key properties of [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate?
[2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate has a molecular weight of 403.48 g/mol, XLogP of 2.41, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-adamantyloxy)-2-oxoethyl] 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate is sourced from PubChem (CID 22752915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).