methyl 3-methyltetradec-13-enoate

C16H30O2 — CID 22752955

IUPACmethyl 3-methyltetradec-13-enoate
SMILESC=CCCCCCCCCCC(C)CC(=O)OC
InChIInChI=1S/C16H30O2/c1-4-5-6-7-8-9-10-11-12-13-15(2)14-16(17)18-3/h4,15H,1,5-14H2,2-3H3
InChIKeyZRBZQXWYQFJZCB-UHFFFAOYSA-N
MW254.41 g/mol
LogP4.88
Rot. Bonds12

About methyl 3-methyltetradec-13-enoate

methyl 3-methyltetradec-13-enoate (PubChem CID 22752955) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is methyl 3-methyltetradec-13-enoate.

Molecular Properties

Compound Namemethyl 3-methyltetradec-13-enoate
PubChem CID22752955
Molecular FormulaC16H30O2
Molecular Weight254.41 g/mol
Exact Mass254.22
IUPAC Namemethyl 3-methyltetradec-13-enoate
SMILESC=CCCCCCCCCCC(C)CC(=O)OC
InChIInChI=1S/C16H30O2/c1-4-5-6-7-8-9-10-11-12-13-15(2)14-16(17)18-3/h4,15H,1,5-14H2,2-3H3
InChIKeyZRBZQXWYQFJZCB-UHFFFAOYSA-N
XLogP4.88
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.41
LogP ≤ 54.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 3-methyltetradec-13-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methyltetradec-13-enoate?
The IUPAC name of methyl 3-methyltetradec-13-enoate (CID 22752955) is methyl 3-methyltetradec-13-enoate.
What is the SMILES notation for methyl 3-methyltetradec-13-enoate?
The canonical SMILES for methyl 3-methyltetradec-13-enoate is C=CCCCCCCCCCC(C)CC(=O)OC.
What is the InChIKey of methyl 3-methyltetradec-13-enoate?
The InChIKey is ZRBZQXWYQFJZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-4-5-6-7-8-9-10-11-12-13-15(2)14-16(17)18-3/h4,15H,1,5-14H2,2-3H3.
What are the key properties of methyl 3-methyltetradec-13-enoate?
methyl 3-methyltetradec-13-enoate has a molecular weight of 254.41 g/mol, XLogP of 4.88, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyltetradec-13-enoate is sourced from PubChem (CID 22752955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).