C24H14N4O4 — CID 22753035
1,4-bis(2-pyridin-2-yl-3-pyridinyl)butane-1,2,3,4-tetrone (PubChem CID 22753035) has the molecular formula C24H14N4O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 1,4-bis(2-pyridin-2-yl-3-pyridinyl)butane-1,2,3,4-tetrone.
| Compound Name | 1,4-bis(2-pyridin-2-yl-3-pyridinyl)butane-1,2,3,4-tetrone |
|---|---|
| PubChem CID | 22753035 |
| Molecular Formula | C24H14N4O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1,4-bis(2-pyridin-2-yl-3-pyridinyl)butane-1,2,3,4-tetrone |
| SMILES | O=C(C(=O)C(=O)c1cccnc1-c1ccccn1)C(=O)c1cccnc1-c1ccccn1 |
| InChI | InChI=1S/C24H14N4O4/c29-21(15-7-5-13-27-19(15)17-9-1-3-11-25-17)23(31)24(32)22(30)16-8-6-14-28-20(16)18-10-2-4-12-26-18/h1-14H |
| InChIKey | FSXTUBYIITZKCB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 119.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|