C24H18O4S — CID 22753270
[4-[3-(4-hydroxybenzoyl)-1-benzothiophen-2-yl]phenyl] propanoate (PubChem CID 22753270) has the molecular formula C24H18O4S and a molecular weight of 402.47 g/mol. Its IUPAC name is [4-[3-(4-hydroxybenzoyl)-1-benzothiophen-2-yl]phenyl] propanoate.
| Compound Name | [4-[3-(4-hydroxybenzoyl)-1-benzothiophen-2-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 22753270 |
| Molecular Formula | C24H18O4S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [4-[3-(4-hydroxybenzoyl)-1-benzothiophen-2-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(-c2sc3ccccc3c2C(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H18O4S/c1-2-21(26)28-18-13-9-16(10-14-18)24-22(19-5-3-4-6-20(19)29-24)23(27)15-7-11-17(25)12-8-15/h3-14,25H,2H2,1H3 |
| InChIKey | JFEWWIPWLOBVKY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|