About 7-(trifluoromethyl)-2,3-dihydroinden-1-one
7-(trifluoromethyl)-2,3-dihydroinden-1-one (PubChem CID 22754140) has the molecular formula C10H7F3O
and a molecular weight of 200.16 g/mol. Its IUPAC name is 7-(trifluoromethyl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-2,3-dihydroinden-1-one |
| PubChem CID | 22754140 |
| Molecular Formula | C10H7F3O |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 7-(trifluoromethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C10H7F3O/c11-10(12,13)7-3-1-2-6-4-5-8(14)9(6)7/h1-3H,4-5H2 |
| InChIKey | RHHGHWBHOQXKNZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(trifluoromethyl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-2,3-dihydroinden-1-one?
The IUPAC name of 7-(trifluoromethyl)-2,3-dihydroinden-1-one (CID 22754140) is 7-(trifluoromethyl)-2,3-dihydroinden-1-one.
What is the SMILES notation for 7-(trifluoromethyl)-2,3-dihydroinden-1-one?
The canonical SMILES for 7-(trifluoromethyl)-2,3-dihydroinden-1-one is O=C1CCc2cccc(C(F)(F)F)c21.
What is the InChIKey of 7-(trifluoromethyl)-2,3-dihydroinden-1-one?
The InChIKey is RHHGHWBHOQXKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3O/c11-10(12,13)7-3-1-2-6-4-5-8(14)9(6)7/h1-3H,4-5H2.
What are the key properties of 7-(trifluoromethyl)-2,3-dihydroinden-1-one?
7-(trifluoromethyl)-2,3-dihydroinden-1-one has a molecular weight of 200.16 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 22754140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).