About [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate
[3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate (PubChem CID 22754197) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate.
Molecular Properties
| Compound Name | [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate |
| PubChem CID | 22754197 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate |
| SMILES | CCC(=O)OCC1=C(COC(=O)CC)C2C=CC1C2 |
| InChI | InChI=1S/C15H20O4/c1-3-14(16)18-8-12-10-5-6-11(7-10)13(12)9-19-15(17)4-2/h5-6,10-11H,3-4,7-9H2,1-2H3 |
| InChIKey | MBANYLCTSRGDAJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate?
The IUPAC name of [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate (CID 22754197) is [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate.
What is the SMILES notation for [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate?
The canonical SMILES for [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate is CCC(=O)OCC1=C(COC(=O)CC)C2C=CC1C2.
What is the InChIKey of [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate?
The InChIKey is MBANYLCTSRGDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-3-14(16)18-8-12-10-5-6-11(7-10)13(12)9-19-15(17)4-2/h5-6,10-11H,3-4,7-9H2,1-2H3.
What are the key properties of [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate?
[3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate has a molecular weight of 264.32 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(propanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl propanoate is sourced from PubChem (CID 22754197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).