About [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate
[3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate (PubChem CID 22754209) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate.
Molecular Properties
| Compound Name | [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate |
| PubChem CID | 22754209 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate |
| SMILES | CCCC(=O)OCC1=C(COC(=O)CCC)C2C=CC1C2 |
| InChI | InChI=1S/C17H24O4/c1-3-5-16(18)20-10-14-12-7-8-13(9-12)15(14)11-21-17(19)6-4-2/h7-8,12-13H,3-6,9-11H2,1-2H3 |
| InChIKey | KECMCPICVYJVRF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate?
The IUPAC name of [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate (CID 22754209) is [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate.
What is the SMILES notation for [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate?
The canonical SMILES for [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate is CCCC(=O)OCC1=C(COC(=O)CCC)C2C=CC1C2.
What is the InChIKey of [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate?
The InChIKey is KECMCPICVYJVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c1-3-5-16(18)20-10-14-12-7-8-13(9-12)15(14)11-21-17(19)6-4-2/h7-8,12-13H,3-6,9-11H2,1-2H3.
What are the key properties of [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate?
[3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate has a molecular weight of 292.38 g/mol, XLogP of 3.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(butanoyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methyl butanoate is sourced from PubChem (CID 22754209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).