C38H72N2O4 — CID 22754553
2,2-bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl]decanedioic acid (PubChem CID 22754553) has the molecular formula C38H72N2O4 and a molecular weight of 621.00 g/mol. Its IUPAC name is 2,2-bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl]decanedioic acid.
| Compound Name | 2,2-bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl]decanedioic acid |
|---|---|
| PubChem CID | 22754553 |
| Molecular Formula | C38H72N2O4 |
| Molecular Weight | 621.00 g/mol |
| Exact Mass | 620.55 |
| IUPAC Name | 2,2-bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl]decanedioic acid |
| SMILES | CCC1(C)CCC(C)C(C)(CC)N1CCC(CCCCCCCC(=O)O)(CCN1C(C)(CC)CCC(C)C1(C)CC)C(=O)O |
| InChI | InChI=1S/C38H72N2O4/c1-11-34(7)24-21-30(5)36(9,13-3)39(34)28-26-38(33(43)44,23-19-17-15-16-18-20-32(41)42)27-29-40-35(8,12-2)25-22-31(6)37(40,10)14-4/h30-31H,11-29H2,1-10H3,(H,41,42)(H,43,44) |
| InChIKey | HKURNZHHQVPYBF-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.00 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|