About 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine
1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine (PubChem CID 22754560) has the molecular formula C21H43NO
and a molecular weight of 325.58 g/mol. Its IUPAC name is 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine.
Molecular Properties
| Compound Name | 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine |
| PubChem CID | 22754560 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine |
| SMILES | CC(C)CCC1(C)CCC(CC(C)C)C(C)(CCC(C)C)N1O |
| InChI | InChI=1S/C21H43NO/c1-16(2)9-12-20(7)13-11-19(15-18(5)6)21(8,22(20)23)14-10-17(3)4/h16-19,23H,9-15H2,1-8H3 |
| InChIKey | LNWMCELEPCVEAO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine?
The IUPAC name of 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine (CID 22754560) is 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine.
What is the SMILES notation for 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine?
The canonical SMILES for 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine is CC(C)CCC1(C)CCC(CC(C)C)C(C)(CCC(C)C)N1O.
What is the InChIKey of 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine?
The InChIKey is LNWMCELEPCVEAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO/c1-16(2)9-12-20(7)13-11-19(15-18(5)6)21(8,22(20)23)14-10-17(3)4/h16-19,23H,9-15H2,1-8H3.
What are the key properties of 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine?
1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine has a molecular weight of 325.58 g/mol, XLogP of 6.52, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,6-dimethyl-2,6-bis(3-methylbutyl)-3-(2-methylpropyl)piperidine is sourced from PubChem (CID 22754560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).