C34H64N2O4 — CID 22754566
bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl] hexanedioate (PubChem CID 22754566) has the molecular formula C34H64N2O4 and a molecular weight of 564.90 g/mol. Its IUPAC name is bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl] hexanedioate.
| Compound Name | bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl] hexanedioate |
|---|---|
| PubChem CID | 22754566 |
| Molecular Formula | C34H64N2O4 |
| Molecular Weight | 564.90 g/mol |
| Exact Mass | 564.49 |
| IUPAC Name | bis[2-(2,6-diethyl-2,3,6-trimethylpiperidin-1-yl)ethyl] hexanedioate |
| SMILES | CCC1(C)CCC(C)C(C)(CC)N1CCOC(=O)CCCCC(=O)OCCN1C(C)(CC)CCC(C)C1(C)CC |
| InChI | InChI=1S/C34H64N2O4/c1-11-31(7)21-19-27(5)33(9,13-3)35(31)23-25-39-29(37)17-15-16-18-30(38)40-26-24-36-32(8,12-2)22-20-28(6)34(36,10)14-4/h27-28H,11-26H2,1-10H3 |
| InChIKey | KXCIVTIBXJKOGU-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.90 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|