C17H33NO — CID 22754597
1-(2,2,6,6-tetraethyl-3,5-dimethylpiperidin-1-yl)ethanone (PubChem CID 22754597) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(2,2,6,6-tetraethyl-3,5-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 1-(2,2,6,6-tetraethyl-3,5-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 22754597 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-(2,2,6,6-tetraethyl-3,5-dimethylpiperidin-1-yl)ethanone |
| SMILES | CCC1(CC)C(C)CC(C)C(CC)(CC)N1C(C)=O |
| InChI | InChI=1S/C17H33NO/c1-8-16(9-2)13(5)12-14(6)17(10-3,11-4)18(16)15(7)19/h13-14H,8-12H2,1-7H3 |
| InChIKey | RJJZEUPLJXSVON-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |