C17H13ClN6O3 — CID 22754757
[6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N,N-dimethylcarbamate (PubChem CID 22754757) has the molecular formula C17H13ClN6O3 and a molecular weight of 384.78 g/mol. Its IUPAC name is [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N,N-dimethylcarbamate.
| Compound Name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 22754757 |
| Molecular Formula | C17H13ClN6O3 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1c2nccnc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C17H13ClN6O3/c1-23(2)17(26)27-16-13-12(19-7-8-20-13)15(25)24(16)11-6-4-9-3-5-10(18)21-14(9)22-11/h3-8,16H,1-2H3 |
| InChIKey | VSFTZLPLDDRCTL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|