C20H24N2O — CID 22754795
2-(3,5-ditert-butylphenyl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 22754795) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-(3,5-ditert-butylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 22754795 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CC(C)(C)c1cc(-c2nc3ncccc3o2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24N2O/c1-19(2,3)14-10-13(11-15(12-14)20(4,5)6)18-22-17-16(23-18)8-7-9-21-17/h7-12H,1-6H3 |
| InChIKey | UCCDZBDMCRACIY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |