C9H19N3O5 — CID 22754877
1-(2-aminoethyl)-3-butylurea;oxalic acid (PubChem CID 22754877) has the molecular formula C9H19N3O5 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-butylurea;oxalic acid.
| Compound Name | 1-(2-aminoethyl)-3-butylurea;oxalic acid |
|---|---|
| PubChem CID | 22754877 |
| Molecular Formula | C9H19N3O5 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(2-aminoethyl)-3-butylurea;oxalic acid |
| SMILES | CCCCNC(=O)NCCN.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H17N3O.C2H2O4/c1-2-3-5-9-7(11)10-6-4-8;3-1(4)2(5)6/h2-6,8H2,1H3,(H2,9,10,11);(H,3,4)(H,5,6) |
| InChIKey | CXEDYCIOUPWCLJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|