About (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol
(5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol (PubChem CID 22755126) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol.
Molecular Properties
| Compound Name | (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol |
| PubChem CID | 22755126 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol |
| SMILES | CCC(CC)/C(=N\O)C(O)C(CC)CC |
| InChI | InChI=1S/C12H25NO2/c1-5-9(6-2)11(13-15)12(14)10(7-3)8-4/h9-10,12,14-15H,5-8H2,1-4H3/b13-11+ |
| InChIKey | AZEWOGSQSIPXRX-ACCUITESSA-N |
| XLogP | 3.05 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol?
The IUPAC name of (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol (CID 22755126) is (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol.
What is the SMILES notation for (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol?
The canonical SMILES for (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol is CCC(CC)/C(=N\O)C(O)C(CC)CC.
What is the InChIKey of (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol?
The InChIKey is AZEWOGSQSIPXRX-ACCUITESSA-N. The full InChI is InChI=1S/C12H25NO2/c1-5-9(6-2)11(13-15)12(14)10(7-3)8-4/h9-10,12,14-15H,5-8H2,1-4H3/b13-11+.
What are the key properties of (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol?
(5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol has a molecular weight of 215.34 g/mol, XLogP of 3.05, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3,6-diethyl-5-hydroxyiminooctan-4-ol is sourced from PubChem (CID 22755126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).