About 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid
5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid (PubChem CID 22755159) has the molecular formula C13H16N2O7S2
and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid.
Molecular Properties
| Compound Name | 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid |
| PubChem CID | 22755159 |
| Molecular Formula | C13H16N2O7S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid |
| SMILES | CC(C)(C)c1cc(=O)n(-c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)[nH]1 |
| InChI | InChI=1S/C13H16N2O7S2/c1-13(2,3)11-7-12(16)15(14-11)8-4-9(23(17,18)19)6-10(5-8)24(20,21)22/h4-7,14H,1-3H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | JDBWDAPPRZDOGI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid?
The IUPAC name of 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid (CID 22755159) is 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid.
What is the SMILES notation for 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid?
The canonical SMILES for 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid is CC(C)(C)c1cc(=O)n(-c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)[nH]1.
What is the InChIKey of 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid?
The InChIKey is JDBWDAPPRZDOGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O7S2/c1-13(2,3)11-7-12(16)15(14-11)8-4-9(23(17,18)19)6-10(5-8)24(20,21)22/h4-7,14H,1-3H3,(H,17,18,19)(H,20,21,22).
What are the key properties of 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid?
5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid has a molecular weight of 376.41 g/mol, XLogP of 0.96, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-tert-butyl-3-oxo-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid is sourced from PubChem (CID 22755159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).