C14H18N2O7S2 — CID 22755175
4-(3-oxo-5-pentyl-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid (PubChem CID 22755175) has the molecular formula C14H18N2O7S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-(3-oxo-5-pentyl-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(3-oxo-5-pentyl-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 22755175 |
| Molecular Formula | C14H18N2O7S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-(3-oxo-5-pentyl-1H-pyrazol-2-yl)benzene-1,3-disulfonic acid |
| SMILES | CCCCCc1cc(=O)n(-c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)[nH]1 |
| InChI | InChI=1S/C14H18N2O7S2/c1-2-3-4-5-10-8-14(17)16(15-10)12-7-6-11(24(18,19)20)9-13(12)25(21,22)23/h6-9,15H,2-5H2,1H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | GKMXMIUYRPYYDV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|